C15H17FN4O2S — CID 56819872
N-[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-4-ethylthiadiazole-5-carboxamide (PubChem CID 56819872) has the molecular formula C15H17FN4O2S and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 56819872 |
| Molecular Formula | C15H17FN4O2S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C15H17FN4O2S/c1-2-12-13(23-20-19-12)15(22)18-8-10(14(17)21)7-9-3-5-11(16)6-4-9/h3-6,10H,2,7-8H2,1H3,(H2,17,21)(H,18,22) |
| InChIKey | XBOVEVCTHLRUBX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |