C17H19FN2O3 — CID 95583298
N-[(2S)-3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-5-ethylfuran-2-carboxamide (PubChem CID 95583298) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is N-[(2S)-3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-5-ethylfuran-2-carboxamide.
| Compound Name | N-[(2S)-3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-5-ethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 95583298 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[(2S)-3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-5-ethylfuran-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NC[C@H](Cc2ccc(F)cc2)C(N)=O)o1 |
| InChI | InChI=1S/C17H19FN2O3/c1-2-14-7-8-15(23-14)17(22)20-10-12(16(19)21)9-11-3-5-13(18)6-4-11/h3-8,12H,2,9-10H2,1H3,(H2,19,21)(H,20,22)/t12-/m0/s1 |
| InChIKey | LHONUUBWYQPLPV-LBPRGKRZSA-N |
| XLogP | 2.06 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |