C17H14Cl2F2N2O2 — CID 60587400
N-[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-2,4-dichloro-5-fluorobenzamide (PubChem CID 60587400) has the molecular formula C17H14Cl2F2N2O2 and a molecular weight of 387.21 g/mol. Its IUPAC name is N-[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-2,4-dichloro-5-fluorobenzamide.
| Compound Name | N-[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-2,4-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 60587400 |
| Molecular Formula | C17H14Cl2F2N2O2 |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | N-[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]-2,4-dichloro-5-fluorobenzamide |
| SMILES | NC(=O)C(CNC(=O)c1cc(F)c(Cl)cc1Cl)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14Cl2F2N2O2/c18-13-7-14(19)15(21)6-12(13)17(25)23-8-10(16(22)24)5-9-1-3-11(20)4-2-9/h1-4,6-7,10H,5,8H2,(H2,22,24)(H,23,25) |
| InChIKey | KOGXKJKEQHRVFT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|