C16H12N4OS2 — CID 940243
N-[(4-phenyl-1,3-thiazol-2-yl)carbamothioyl]pyridine-3-carboxamide (PubChem CID 940243) has the molecular formula C16H12N4OS2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[(4-phenyl-1,3-thiazol-2-yl)carbamothioyl]pyridine-3-carboxamide.
| Compound Name | N-[(4-phenyl-1,3-thiazol-2-yl)carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 940243 |
| Molecular Formula | C16H12N4OS2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-[(4-phenyl-1,3-thiazol-2-yl)carbamothioyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc(-c2ccccc2)cs1)c1cccnc1 |
| InChI | InChI=1S/C16H12N4OS2/c21-14(12-7-4-8-17-9-12)19-15(22)20-16-18-13(10-23-16)11-5-2-1-3-6-11/h1-10H,(H2,18,19,20,21,22) |
| InChIKey | QGMLHNNQSAGLRQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|