C13H16N4O2S — CID 94024674
1-[(1S)-1-(4-methoxyphenyl)propyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 94024674) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-[(1S)-1-(4-methoxyphenyl)propyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(1S)-1-(4-methoxyphenyl)propyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 94024674 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[(1S)-1-(4-methoxyphenyl)propyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | CC[C@H](NC(=O)Nc1nncs1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H16N4O2S/c1-3-11(9-4-6-10(19-2)7-5-9)15-12(18)16-13-17-14-8-20-13/h4-8,11H,3H2,1-2H3,(H2,15,16,17,18)/t11-/m0/s1 |
| InChIKey | KNBMEPQYKXISSI-NSHDSACASA-N |
| XLogP | 2.82 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |