C13H13N3O3S — CID 49024048
4-(4-methoxyphenyl)-4-oxo-N-(1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 49024048) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-4-oxo-N-(1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-(4-methoxyphenyl)-4-oxo-N-(1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 49024048 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-(4-methoxyphenyl)-4-oxo-N-(1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)Nc2nncs2)cc1 |
| InChI | InChI=1S/C13H13N3O3S/c1-19-10-4-2-9(3-5-10)11(17)6-7-12(18)15-13-16-14-8-20-13/h2-5,8H,6-7H2,1H3,(H,15,16,18) |
| InChIKey | LJAIJCCRMWNJSO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |