C13H15N3O2S — CID 649235
4-(4-methylphenoxy)-N-(1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 649235) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-(4-methylphenoxy)-N-(1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-(4-methylphenoxy)-N-(1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 649235 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-(4-methylphenoxy)-N-(1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)Nc2nncs2)cc1 |
| InChI | InChI=1S/C13H15N3O2S/c1-10-4-6-11(7-5-10)18-8-2-3-12(17)15-13-16-14-9-19-13/h4-7,9H,2-3,8H2,1H3,(H,15,16,17) |
| InChIKey | QXGKTCLCCWAIRH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|