C17H23N3O2S — CID 2072136
4-[4-(2-methylbutan-2-yl)phenoxy]-N-(1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 2072136) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 4-[4-(2-methylbutan-2-yl)phenoxy]-N-(1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-[4-(2-methylbutan-2-yl)phenoxy]-N-(1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2072136 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-[4-(2-methylbutan-2-yl)phenoxy]-N-(1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Nc2nncs2)cc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-17(2,3)13-7-9-14(10-8-13)22-11-5-6-15(21)19-16-20-18-12-23-16/h7-10,12H,4-6,11H2,1-3H3,(H,19,20,21) |
| InChIKey | RTLDCCQLSHWSNO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|