C19H24N2O4S — CID 45388130
2-[2-[4-(4-tert-butylphenoxy)butanoylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 45388130) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[2-[4-(4-tert-butylphenoxy)butanoylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[4-(4-tert-butylphenoxy)butanoylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 45388130 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[2-[4-(4-tert-butylphenoxy)butanoylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)Nc2nc(CC(=O)O)cs2)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-19(2,3)13-6-8-15(9-7-13)25-10-4-5-16(22)21-18-20-14(12-26-18)11-17(23)24/h6-9,12H,4-5,10-11H2,1-3H3,(H,23,24)(H,20,21,22) |
| InChIKey | IQCMSXLJEOERFA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|