C14H25N3O2S — CID 94025295
[methyl-[(2R)-1-[[methyl(propan-2-yl)sulfamoyl]amino]propan-2-yl]amino]benzene (PubChem CID 94025295) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is [methyl-[(2R)-1-[[methyl(propan-2-yl)sulfamoyl]amino]propan-2-yl]amino]benzene.
| Compound Name | [methyl-[(2R)-1-[[methyl(propan-2-yl)sulfamoyl]amino]propan-2-yl]amino]benzene |
|---|---|
| PubChem CID | 94025295 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | [methyl-[(2R)-1-[[methyl(propan-2-yl)sulfamoyl]amino]propan-2-yl]amino]benzene |
| SMILES | CC(C)N(C)S(=O)(=O)NC[C@@H](C)N(C)c1ccccc1 |
| InChI | InChI=1S/C14H25N3O2S/c1-12(2)17(5)20(18,19)15-11-13(3)16(4)14-9-7-6-8-10-14/h6-10,12-13,15H,11H2,1-5H3/t13-/m1/s1 |
| InChIKey | JXAFTOWOMMNFLE-CYBMUJFWSA-N |
| XLogP | 1.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |