C18H34N4O4S2 — CID 124880366
[(2R,3S)-3,4-bis[[methyl(propan-2-yl)sulfamoyl]amino]butan-2-yl]benzene (PubChem CID 124880366) has the molecular formula C18H34N4O4S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is [(2R,3S)-3,4-bis[[methyl(propan-2-yl)sulfamoyl]amino]butan-2-yl]benzene.
| Compound Name | [(2R,3S)-3,4-bis[[methyl(propan-2-yl)sulfamoyl]amino]butan-2-yl]benzene |
|---|---|
| PubChem CID | 124880366 |
| Molecular Formula | C18H34N4O4S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | [(2R,3S)-3,4-bis[[methyl(propan-2-yl)sulfamoyl]amino]butan-2-yl]benzene |
| SMILES | CC(C)N(C)S(=O)(=O)NC[C@@H](NS(=O)(=O)N(C)C(C)C)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H34N4O4S2/c1-14(2)21(6)27(23,24)19-13-18(16(5)17-11-9-8-10-12-17)20-28(25,26)22(7)15(3)4/h8-12,14-16,18-20H,13H2,1-7H3/t16-,18-/m1/s1 |
| InChIKey | GCVYRORWFHIPJJ-SJLPKXTDSA-N |
| XLogP | 1.51 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |