C14H26N6O2 — CID 94028435
N-[(2R)-2-hydroxypropyl]-1-[(1-propyltetrazol-5-yl)methyl]piperidine-4-carboxamide (PubChem CID 94028435) has the molecular formula C14H26N6O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-1-[(1-propyltetrazol-5-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-1-[(1-propyltetrazol-5-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 94028435 |
| Molecular Formula | C14H26N6O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-1-[(1-propyltetrazol-5-yl)methyl]piperidine-4-carboxamide |
| SMILES | CCCn1nnnc1CN1CCC(C(=O)NC[C@@H](C)O)CC1 |
| InChI | InChI=1S/C14H26N6O2/c1-3-6-20-13(16-17-18-20)10-19-7-4-12(5-8-19)14(22)15-9-11(2)21/h11-12,21H,3-10H2,1-2H3,(H,15,22)/t11-/m1/s1 |
| InChIKey | ZZWUWFHNQWSHMC-LLVKDONJSA-N |
| XLogP | -0.21 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |