C15H25N5O2 — CID 94030105
1-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea (PubChem CID 94030105) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea.
| Compound Name | 1-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 94030105 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 1-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
| SMILES | C[C@H](NC(=O)NCc1nnc2n1CCCCC2)[C@H]1CCCO1 |
| InChI | InChI=1S/C15H25N5O2/c1-11(12-6-5-9-22-12)17-15(21)16-10-14-19-18-13-7-3-2-4-8-20(13)14/h11-12H,2-10H2,1H3,(H2,16,17,21)/t11-,12+/m0/s1 |
| InChIKey | PUWNRFJBAGQRSJ-NWDGAFQWSA-N |
| XLogP | 1.37 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |