C15H26N6O — CID 60562914
1-(1-methylpiperidin-3-yl)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea (PubChem CID 60562914) has the molecular formula C15H26N6O and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(1-methylpiperidin-3-yl)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea.
| Compound Name | 1-(1-methylpiperidin-3-yl)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 60562914 |
| Molecular Formula | C15H26N6O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-(1-methylpiperidin-3-yl)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
| SMILES | CN1CCCC(NC(=O)NCc2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C15H26N6O/c1-20-8-5-6-12(11-20)17-15(22)16-10-14-19-18-13-7-3-2-4-9-21(13)14/h12H,2-11H2,1H3,(H2,16,17,22) |
| InChIKey | QFFASCPAFYVPDY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |