C13H21N5O3S — CID 71894169
1-(1,1-dioxothiolan-3-yl)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea (PubChem CID 71894169) has the molecular formula C13H21N5O3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 71894169 |
| Molecular Formula | C13H21N5O3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
| SMILES | O=C(NCc1nnc2n1CCCCC2)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H21N5O3S/c19-13(15-10-5-7-22(20,21)9-10)14-8-12-17-16-11-4-2-1-3-6-18(11)12/h10H,1-9H2,(H2,14,15,19) |
| InChIKey | GCXRGRKIKMZZTH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |