C14H24N6O — CID 125177511
(3S)-1-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-ylmethyl)piperidine-3-carboxamide (PubChem CID 125177511) has the molecular formula C14H24N6O and a molecular weight of 292.39 g/mol. Its IUPAC name is (3S)-1-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125177511 |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3S)-1-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-ylmethyl)piperidine-3-carboxamide |
| SMILES | CN1CCC[C@H](C(=O)NCc2nnc3n2CCNCC3)C1 |
| InChI | InChI=1S/C14H24N6O/c1-19-7-2-3-11(10-19)14(21)16-9-13-18-17-12-4-5-15-6-8-20(12)13/h11,15H,2-10H2,1H3,(H,16,21)/t11-/m0/s1 |
| InChIKey | VLESHZUSIARVPJ-NSHDSACASA-N |
| XLogP | -0.62 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |