C13H22N6O — CID 118759795
1-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 118759795) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118759795 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | CN1CCC(C(=O)NCc2nnc3n2CCNCC3)C1 |
| InChI | InChI=1S/C13H22N6O/c1-18-6-3-10(9-18)13(20)15-8-12-17-16-11-2-4-14-5-7-19(11)12/h10,14H,2-9H2,1H3,(H,15,20) |
| InChIKey | QTDMJTNBIVSIBY-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |