C19H33N5O — CID 99824695
1-[(1R,4S)-4-methylcycloheptyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]urea (PubChem CID 99824695) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is 1-[(1R,4S)-4-methylcycloheptyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]urea.
| Compound Name | 1-[(1R,4S)-4-methylcycloheptyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]urea |
|---|---|
| PubChem CID | 99824695 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | 1-[(1R,4S)-4-methylcycloheptyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]urea |
| SMILES | C[C@H]1CCC[C@@H](NC(=O)NCCCc2nnc3n2CCCCC3)CC1 |
| InChI | InChI=1S/C19H33N5O/c1-15-7-5-8-16(12-11-15)21-19(25)20-13-6-10-18-23-22-17-9-3-2-4-14-24(17)18/h15-16H,2-14H2,1H3,(H2,20,21,25)/t15-,16+/m0/s1 |
| InChIKey | HFFNNGKRRUDELX-JKSUJKDBSA-N |
| XLogP | 3.21 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|