C18H27N5O — CID 94030932
(3R)-N-(4-methylpentyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carboxamide (PubChem CID 94030932) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is (3R)-N-(4-methylpentyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carboxamide.
| Compound Name | (3R)-N-(4-methylpentyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 94030932 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (3R)-N-(4-methylpentyl)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carboxamide |
| SMILES | CC(C)CCCNC(=O)N1CCC[C@@H](c2nnc3ccccn23)C1 |
| InChI | InChI=1S/C18H27N5O/c1-14(2)7-5-10-19-18(24)22-11-6-8-15(13-22)17-21-20-16-9-3-4-12-23(16)17/h3-4,9,12,14-15H,5-8,10-11,13H2,1-2H3,(H,19,24)/t15-/m1/s1 |
| InChIKey | BUGKMFJZKYNULJ-OAHLLOKOSA-N |
| XLogP | 3.05 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|