C16H20N6O — CID 94032264
(2S)-1-[methyl-[(2-phenyltriazol-4-yl)methyl]amino]-3-pyrazol-1-ylpropan-2-ol (PubChem CID 94032264) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is (2S)-1-[methyl-[(2-phenyltriazol-4-yl)methyl]amino]-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | (2S)-1-[methyl-[(2-phenyltriazol-4-yl)methyl]amino]-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 94032264 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2S)-1-[methyl-[(2-phenyltriazol-4-yl)methyl]amino]-3-pyrazol-1-ylpropan-2-ol |
| SMILES | CN(Cc1cnn(-c2ccccc2)n1)C[C@H](O)Cn1cccn1 |
| InChI | InChI=1S/C16H20N6O/c1-20(12-16(23)13-21-9-5-8-17-21)11-14-10-18-22(19-14)15-6-3-2-4-7-15/h2-10,16,23H,11-13H2,1H3/t16-/m0/s1 |
| InChIKey | GQNDAFMKSJKNDX-INIZCTEOSA-N |
| XLogP | 0.96 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |