C14H22N2O5S — CID 94032684
methyl 5-[[(3S)-3-(methanesulfonamido)piperidin-1-yl]methyl]-3-methylfuran-2-carboxylate (PubChem CID 94032684) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is methyl 5-[[(3S)-3-(methanesulfonamido)piperidin-1-yl]methyl]-3-methylfuran-2-carboxylate.
| Compound Name | methyl 5-[[(3S)-3-(methanesulfonamido)piperidin-1-yl]methyl]-3-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 94032684 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl 5-[[(3S)-3-(methanesulfonamido)piperidin-1-yl]methyl]-3-methylfuran-2-carboxylate |
| SMILES | COC(=O)c1oc(CN2CCC[C@H](NS(C)(=O)=O)C2)cc1C |
| InChI | InChI=1S/C14H22N2O5S/c1-10-7-12(21-13(10)14(17)20-2)9-16-6-4-5-11(8-16)15-22(3,18)19/h7,11,15H,4-6,8-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | LWFORMDAAJGYNF-NSHDSACASA-N |
| XLogP | 0.89 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |