C12H18N2O3 — CID 43162328
methyl 3-methyl-5-(piperazin-1-ylmethyl)furan-2-carboxylate (PubChem CID 43162328) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is methyl 3-methyl-5-(piperazin-1-ylmethyl)furan-2-carboxylate.
| Compound Name | methyl 3-methyl-5-(piperazin-1-ylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 43162328 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methyl 3-methyl-5-(piperazin-1-ylmethyl)furan-2-carboxylate |
| SMILES | COC(=O)c1oc(CN2CCNCC2)cc1C |
| InChI | InChI=1S/C12H18N2O3/c1-9-7-10(17-11(9)12(15)16-2)8-14-5-3-13-4-6-14/h7,13H,3-6,8H2,1-2H3 |
| InChIKey | IOPWRSLJIWVIFQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |