C11H13N3O2 — CID 94037432
(1S,7R,8S,11S)-4-methyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione (PubChem CID 94037432) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is (1S,7R,8S,11S)-4-methyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione.
| Compound Name | (1S,7R,8S,11S)-4-methyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione |
|---|---|
| PubChem CID | 94037432 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | (1S,7R,8S,11S)-4-methyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@H]1C=C[C@@H]2[C@H]2CC[C@@H]21 |
| InChI | InChI=1S/C11H13N3O2/c1-12-10(15)13-8-4-5-9(14(13)11(12)16)7-3-2-6(7)8/h4-9H,2-3H2,1H3/t6-,7-,8-,9+/m0/s1 |
| InChIKey | HUNGCLDGWKKTFZ-XSPKLOCKSA-N |
| XLogP | 0.04 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|