C19H34N6O — CID 94054508
N-[(2R)-2-(diethylamino)-4-methylpentyl]-4-pyrazin-2-ylpiperazine-1-carboxamide (PubChem CID 94054508) has the molecular formula C19H34N6O and a molecular weight of 362.52 g/mol. Its IUPAC name is N-[(2R)-2-(diethylamino)-4-methylpentyl]-4-pyrazin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[(2R)-2-(diethylamino)-4-methylpentyl]-4-pyrazin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 94054508 |
| Molecular Formula | C19H34N6O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | N-[(2R)-2-(diethylamino)-4-methylpentyl]-4-pyrazin-2-ylpiperazine-1-carboxamide |
| SMILES | CCN(CC)[C@@H](CNC(=O)N1CCN(c2cnccn2)CC1)CC(C)C |
| InChI | InChI=1S/C19H34N6O/c1-5-23(6-2)17(13-16(3)4)14-22-19(26)25-11-9-24(10-12-25)18-15-20-7-8-21-18/h7-8,15-17H,5-6,9-14H2,1-4H3,(H,22,26)/t17-/m1/s1 |
| InChIKey | BQJQPMMIZFOPET-QGZVFWFLSA-N |
| XLogP | 2.06 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |