C19H28N6OS — CID 47030817
N-[2-(diethylamino)-2-thiophen-3-ylethyl]-4-pyrazin-2-ylpiperazine-1-carboxamide (PubChem CID 47030817) has the molecular formula C19H28N6OS and a molecular weight of 388.54 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-thiophen-3-ylethyl]-4-pyrazin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-4-pyrazin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 47030817 |
| Molecular Formula | C19H28N6OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-4-pyrazin-2-ylpiperazine-1-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)N1CCN(c2cnccn2)CC1)c1ccsc1 |
| InChI | InChI=1S/C19H28N6OS/c1-3-23(4-2)17(16-5-12-27-15-16)13-22-19(26)25-10-8-24(9-11-25)18-14-20-6-7-21-18/h5-7,12,14-15,17H,3-4,8-11,13H2,1-2H3,(H,22,26) |
| InChIKey | GEPIQSNNEMIOJU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |