C23H32N4O2S — CID 38391003
4-(4-acetylphenyl)-N-[(2R)-2-(diethylamino)-2-thiophen-3-ylethyl]piperazine-1-carboxamide (PubChem CID 38391003) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is 4-(4-acetylphenyl)-N-[(2R)-2-(diethylamino)-2-thiophen-3-ylethyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-acetylphenyl)-N-[(2R)-2-(diethylamino)-2-thiophen-3-ylethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 38391003 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 4-(4-acetylphenyl)-N-[(2R)-2-(diethylamino)-2-thiophen-3-ylethyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)[C@@H](CNC(=O)N1CCN(c2ccc(C(C)=O)cc2)CC1)c1ccsc1 |
| InChI | InChI=1S/C23H32N4O2S/c1-4-25(5-2)22(20-10-15-30-17-20)16-24-23(29)27-13-11-26(12-14-27)21-8-6-19(7-9-21)18(3)28/h6-10,15,17,22H,4-5,11-14,16H2,1-3H3,(H,24,29)/t22-/m0/s1 |
| InChIKey | WOCSKJMWOJNWDL-QFIPXVFZSA-N |
| XLogP | 3.87 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |