C17H24FN3O4S — CID 9406370
(3R)-1-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoyl]piperidine-3-carboxamide (PubChem CID 9406370) has the molecular formula C17H24FN3O4S and a molecular weight of 385.46 g/mol. Its IUPAC name is (3R)-1-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 9406370 |
| Molecular Formula | C17H24FN3O4S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (3R)-1-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoyl]piperidine-3-carboxamide |
| SMILES | CN(CCCC(=O)N1CCC[C@@H](C(N)=O)C1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H24FN3O4S/c1-20(26(24,25)15-8-6-14(18)7-9-15)10-3-5-16(22)21-11-2-4-13(12-21)17(19)23/h6-9,13H,2-5,10-12H2,1H3,(H2,19,23)/t13-/m1/s1 |
| InChIKey | LFXKPZZDOHLLLU-CYBMUJFWSA-N |
| XLogP | 0.95 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |