C11H10N4OS — CID 94069244
3-ethyl-5-(5-thiophen-2-yl-1H-pyrazol-3-yl)-1,2,4-oxadiazole (PubChem CID 94069244) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is 3-ethyl-5-(5-thiophen-2-yl-1H-pyrazol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3-ethyl-5-(5-thiophen-2-yl-1H-pyrazol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 94069244 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-ethyl-5-(5-thiophen-2-yl-1H-pyrazol-3-yl)-1,2,4-oxadiazole |
| SMILES | CCc1noc(-c2cc(-c3cccs3)[nH]n2)n1 |
| InChI | InChI=1S/C11H10N4OS/c1-2-10-12-11(16-15-10)8-6-7(13-14-8)9-4-3-5-17-9/h3-6H,2H2,1H3,(H,13,14) |
| InChIKey | ZVQSRHNSJPCCDS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |