C15H26N4 — CID 94075362
1-[2,6-di(propan-2-yl)pyrimidin-4-yl]piperidin-4-amine (PubChem CID 94075362) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)pyrimidin-4-yl]piperidin-4-amine.
| Compound Name | 1-[2,6-di(propan-2-yl)pyrimidin-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 94075362 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)pyrimidin-4-yl]piperidin-4-amine |
| SMILES | CC(C)c1cc(N2CCC(N)CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C15H26N4/c1-10(2)13-9-14(18-15(17-13)11(3)4)19-7-5-12(16)6-8-19/h9-12H,5-8,16H2,1-4H3 |
| InChIKey | XEPQPMMYEMMFPR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |