C16H23N5O — CID 94078524
1-(2,5-dimethylpyrazol-3-yl)-3-[(2R)-2-(N-methylanilino)propyl]urea (PubChem CID 94078524) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-3-[(2R)-2-(N-methylanilino)propyl]urea.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-3-[(2R)-2-(N-methylanilino)propyl]urea |
|---|---|
| PubChem CID | 94078524 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-3-[(2R)-2-(N-methylanilino)propyl]urea |
| SMILES | Cc1cc(NC(=O)NC[C@@H](C)N(C)c2ccccc2)n(C)n1 |
| InChI | InChI=1S/C16H23N5O/c1-12-10-15(21(4)19-12)18-16(22)17-11-13(2)20(3)14-8-6-5-7-9-14/h5-10,13H,11H2,1-4H3,(H2,17,18,22)/t13-/m1/s1 |
| InChIKey | ADDGFTOTASVIOM-CYBMUJFWSA-N |
| XLogP | 2.37 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |