C22H17NO2S — CID 94086021
(7R)-3-phenyl-7-(4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 94086021) has the molecular formula C22H17NO2S and a molecular weight of 359.45 g/mol. Its IUPAC name is (7R)-3-phenyl-7-(4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | (7R)-3-phenyl-7-(4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 94086021 |
| Molecular Formula | C22H17NO2S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (7R)-3-phenyl-7-(4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | C#CCOc1ccc([C@H]2CC(=O)Nc3c(-c4ccccc4)csc32)cc1 |
| InChI | InChI=1S/C22H17NO2S/c1-2-12-25-17-10-8-16(9-11-17)18-13-20(24)23-21-19(14-26-22(18)21)15-6-4-3-5-7-15/h1,3-11,14,18H,12-13H2,(H,23,24)/t18-/m1/s1 |
| InChIKey | KYHSBNARUGLOBI-GOSISDBHSA-N |
| XLogP | 4.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|