C16H23N3O2S — CID 94087858
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2S)-2-pyrrolidin-1-ylpropyl]thiourea (PubChem CID 94087858) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2S)-2-pyrrolidin-1-ylpropyl]thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2S)-2-pyrrolidin-1-ylpropyl]thiourea |
|---|---|
| PubChem CID | 94087858 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2S)-2-pyrrolidin-1-ylpropyl]thiourea |
| SMILES | C[C@@H](CNC(=S)Nc1ccc2c(c1)OCCO2)N1CCCC1 |
| InChI | InChI=1S/C16H23N3O2S/c1-12(19-6-2-3-7-19)11-17-16(22)18-13-4-5-14-15(10-13)21-9-8-20-14/h4-5,10,12H,2-3,6-9,11H2,1H3,(H2,17,18,22)/t12-/m0/s1 |
| InChIKey | WKELHGBPQVVVLZ-LBPRGKRZSA-N |
| XLogP | 2.23 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|