C23H25F2N3O3 — CID 94091799
(2R)-N-[(2,5-difluorophenyl)methyl]-2-methyl-3-[4-[(4-methylphenyl)methyl]-2,3-dioxopiperazin-1-yl]propanamide (PubChem CID 94091799) has the molecular formula C23H25F2N3O3 and a molecular weight of 429.47 g/mol. Its IUPAC name is (2R)-N-[(2,5-difluorophenyl)methyl]-2-methyl-3-[4-[(4-methylphenyl)methyl]-2,3-dioxopiperazin-1-yl]propanamide.
| Compound Name | (2R)-N-[(2,5-difluorophenyl)methyl]-2-methyl-3-[4-[(4-methylphenyl)methyl]-2,3-dioxopiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 94091799 |
| Molecular Formula | C23H25F2N3O3 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (2R)-N-[(2,5-difluorophenyl)methyl]-2-methyl-3-[4-[(4-methylphenyl)methyl]-2,3-dioxopiperazin-1-yl]propanamide |
| SMILES | Cc1ccc(CN2CCN(C[C@@H](C)C(=O)NCc3cc(F)ccc3F)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C23H25F2N3O3/c1-15-3-5-17(6-4-15)14-28-10-9-27(22(30)23(28)31)13-16(2)21(29)26-12-18-11-19(24)7-8-20(18)25/h3-8,11,16H,9-10,12-14H2,1-2H3,(H,26,29)/t16-/m1/s1 |
| InChIKey | AHXAKBOBJOBEJL-MRXNPFEDSA-N |
| XLogP | 2.40 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|