C21H21F2N3O3 — CID 94091778
(2S)-N-[(2,4-difluorophenyl)methyl]-3-(2,3-dioxo-4-phenylpiperazin-1-yl)-2-methylpropanamide (PubChem CID 94091778) has the molecular formula C21H21F2N3O3 and a molecular weight of 401.41 g/mol. Its IUPAC name is (2S)-N-[(2,4-difluorophenyl)methyl]-3-(2,3-dioxo-4-phenylpiperazin-1-yl)-2-methylpropanamide.
| Compound Name | (2S)-N-[(2,4-difluorophenyl)methyl]-3-(2,3-dioxo-4-phenylpiperazin-1-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 94091778 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (2S)-N-[(2,4-difluorophenyl)methyl]-3-(2,3-dioxo-4-phenylpiperazin-1-yl)-2-methylpropanamide |
| SMILES | C[C@@H](CN1CCN(c2ccccc2)C(=O)C1=O)C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C21H21F2N3O3/c1-14(19(27)24-12-15-7-8-16(22)11-18(15)23)13-25-9-10-26(21(29)20(25)28)17-5-3-2-4-6-17/h2-8,11,14H,9-10,12-13H2,1H3,(H,24,27)/t14-/m0/s1 |
| InChIKey | SFRNGMJYWRPJJQ-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|