C18H25N3O2 — CID 94092803
(4S)-4-(4-benzyl-1,4-diazepane-1-carbonyl)-1-methylpyrrolidin-2-one (PubChem CID 94092803) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (4S)-4-(4-benzyl-1,4-diazepane-1-carbonyl)-1-methylpyrrolidin-2-one.
| Compound Name | (4S)-4-(4-benzyl-1,4-diazepane-1-carbonyl)-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 94092803 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (4S)-4-(4-benzyl-1,4-diazepane-1-carbonyl)-1-methylpyrrolidin-2-one |
| SMILES | CN1C[C@@H](C(=O)N2CCCN(Cc3ccccc3)CC2)CC1=O |
| InChI | InChI=1S/C18H25N3O2/c1-19-14-16(12-17(19)22)18(23)21-9-5-8-20(10-11-21)13-15-6-3-2-4-7-15/h2-4,6-7,16H,5,8-14H2,1H3/t16-/m0/s1 |
| InChIKey | XKCBZCDXVZYEFW-INIZCTEOSA-N |
| XLogP | 1.20 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |