C11H18N2O2 — CID 94096526
N-[(2R)-2-(dimethylamino)propyl]-5-methylfuran-2-carboxamide (PubChem CID 94096526) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)propyl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[(2R)-2-(dimethylamino)propyl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 94096526 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)propyl]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC[C@@H](C)N(C)C)o1 |
| InChI | InChI=1S/C11H18N2O2/c1-8(13(3)4)7-12-11(14)10-6-5-9(2)15-10/h5-6,8H,7H2,1-4H3,(H,12,14)/t8-/m1/s1 |
| InChIKey | FWWNRBJFYTWDSR-MRVPVSSYSA-N |
| XLogP | 1.27 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |