C15H19N7OS — CID 9409797
1-[[(2R)-oxolan-2-yl]methyl]-3-[(Z)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]thiourea (PubChem CID 9409797) has the molecular formula C15H19N7OS and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-[[(2R)-oxolan-2-yl]methyl]-3-[(Z)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]thiourea.
| Compound Name | 1-[[(2R)-oxolan-2-yl]methyl]-3-[(Z)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 9409797 |
| Molecular Formula | C15H19N7OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-[[(2R)-oxolan-2-yl]methyl]-3-[(Z)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]thiourea |
| SMILES | C/C(=N/NC(=S)NC[C@H]1CCCO1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C15H19N7OS/c1-11(18-19-15(24)16-9-14-6-3-7-23-14)12-4-2-5-13(8-12)22-10-17-20-21-22/h2,4-5,8,10,14H,3,6-7,9H2,1H3,(H2,16,19,24)/b18-11-/t14-/m1/s1 |
| InChIKey | QZURWVMXUGOZQC-JVVDOCDTSA-N |
| XLogP | 1.03 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|