C18H17N3O3 — CID 94103538
(2R)-N-(1-phenylbenzimidazol-2-yl)-1,4-dioxane-2-carboxamide (PubChem CID 94103538) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R)-N-(1-phenylbenzimidazol-2-yl)-1,4-dioxane-2-carboxamide.
| Compound Name | (2R)-N-(1-phenylbenzimidazol-2-yl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 94103538 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2R)-N-(1-phenylbenzimidazol-2-yl)-1,4-dioxane-2-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2n1-c1ccccc1)[C@H]1COCCO1 |
| InChI | InChI=1S/C18H17N3O3/c22-17(16-12-23-10-11-24-16)20-18-19-14-8-4-5-9-15(14)21(18)13-6-2-1-3-7-13/h1-9,16H,10-12H2,(H,19,20,22)/t16-/m1/s1 |
| InChIKey | XROATIWRTBSDJS-MRXNPFEDSA-N |
| XLogP | 2.38 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |