About 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide (PubChem CID 94116174) has the molecular formula C15H25N3O2S
and a molecular weight of 311.45 g/mol. Its IUPAC name is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide.
Molecular Properties
| Compound Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide |
| PubChem CID | 94116174 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide |
| SMILES | Cc1csc(=O)n1CCC(=O)NCCN1CCC[C@H](C)C1 |
| InChI | InChI=1S/C15H25N3O2S/c1-12-4-3-7-17(10-12)9-6-16-14(19)5-8-18-13(2)11-21-15(18)20/h11-12H,3-10H2,1-2H3,(H,16,19)/t12-/m0/s1 |
| InChIKey | VOGGFAHGFGUPBO-LBPRGKRZSA-N |
| XLogP | 1.46 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide?
The IUPAC name of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide (CID 94116174) is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide.
What is the SMILES notation for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide?
The canonical SMILES for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide is Cc1csc(=O)n1CCC(=O)NCCN1CCC[C@H](C)C1.
What is the InChIKey of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide?
The InChIKey is VOGGFAHGFGUPBO-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H25N3O2S/c1-12-4-3-7-17(10-12)9-6-16-14(19)5-8-18-13(2)11-21-15(18)20/h11-12H,3-10H2,1-2H3,(H,16,19)/t12-/m0/s1.
What are the key properties of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide?
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide has a molecular weight of 311.45 g/mol, XLogP of 1.46, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]propanamide is sourced from PubChem (CID 94116174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).