C17H23N3O3S — CID 94117692
5,5-dimethyl-3-[4-oxo-4-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]butyl]imidazolidine-2,4-dione (PubChem CID 94117692) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-oxo-4-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]butyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[4-oxo-4-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94117692 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 5,5-dimethyl-3-[4-oxo-4-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]butyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)N2CCC[C@@H]2c2ccsc2)C1=O |
| InChI | InChI=1S/C17H23N3O3S/c1-17(2)15(22)20(16(23)18-17)9-4-6-14(21)19-8-3-5-13(19)12-7-10-24-11-12/h7,10-11,13H,3-6,8-9H2,1-2H3,(H,18,23)/t13-/m1/s1 |
| InChIKey | ODIWAYHCUHLPGC-CYBMUJFWSA-N |
| XLogP | 2.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|