C22H31N3O4 — CID 47013106
3-[4-[2-(4-methoxyphenyl)azepan-1-yl]-4-oxobutyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 47013106) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[4-[2-(4-methoxyphenyl)azepan-1-yl]-4-oxobutyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[2-(4-methoxyphenyl)azepan-1-yl]-4-oxobutyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47013106 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 3-[4-[2-(4-methoxyphenyl)azepan-1-yl]-4-oxobutyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | COc1ccc(C2CCCCCN2C(=O)CCCN2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C22H31N3O4/c1-22(2)20(27)25(21(28)23-22)15-7-9-19(26)24-14-6-4-5-8-18(24)16-10-12-17(29-3)13-11-16/h10-13,18H,4-9,14-15H2,1-3H3,(H,23,28) |
| InChIKey | DZWLGYIEUZUCND-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|