C15H20N4O3S — CID 94139251
(3S)-N-(4-cyanophenyl)-3-(methanesulfonamidomethyl)piperidine-1-carboxamide (PubChem CID 94139251) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is (3S)-N-(4-cyanophenyl)-3-(methanesulfonamidomethyl)piperidine-1-carboxamide.
| Compound Name | (3S)-N-(4-cyanophenyl)-3-(methanesulfonamidomethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 94139251 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (3S)-N-(4-cyanophenyl)-3-(methanesulfonamidomethyl)piperidine-1-carboxamide |
| SMILES | CS(=O)(=O)NC[C@H]1CCCN(C(=O)Nc2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C15H20N4O3S/c1-23(21,22)17-10-13-3-2-8-19(11-13)15(20)18-14-6-4-12(9-16)5-7-14/h4-7,13,17H,2-3,8,10-11H2,1H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | GCYXQXUTXJLZKR-CYBMUJFWSA-N |
| XLogP | 1.35 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |