C14H22N4O4S — CID 94031810
(3R)-3-(methanesulfonamidomethyl)-N-(6-methoxy-3-pyridinyl)piperidine-1-carboxamide (PubChem CID 94031810) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is (3R)-3-(methanesulfonamidomethyl)-N-(6-methoxy-3-pyridinyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-(methanesulfonamidomethyl)-N-(6-methoxy-3-pyridinyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 94031810 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (3R)-3-(methanesulfonamidomethyl)-N-(6-methoxy-3-pyridinyl)piperidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC[C@@H](CNS(C)(=O)=O)C2)cn1 |
| InChI | InChI=1S/C14H22N4O4S/c1-22-13-6-5-12(9-15-13)17-14(19)18-7-3-4-11(10-18)8-16-23(2,20)21/h5-6,9,11,16H,3-4,7-8,10H2,1-2H3,(H,17,19)/t11-/m0/s1 |
| InChIKey | HCLYTLWOZWUDQS-NSHDSACASA-N |
| XLogP | 0.88 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |