C19H31N3O4S — CID 94141161
N-[5-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propylsulfamoyl]-2-methoxyphenyl]acetamide (PubChem CID 94141161) has the molecular formula C19H31N3O4S and a molecular weight of 397.54 g/mol. Its IUPAC name is N-[5-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propylsulfamoyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propylsulfamoyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 94141161 |
| Molecular Formula | C19H31N3O4S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[5-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propylsulfamoyl]-2-methoxyphenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCN2C[C@@H](C)C[C@H](C)C2)cc1NC(C)=O |
| InChI | InChI=1S/C19H31N3O4S/c1-14-10-15(2)13-22(12-14)9-5-8-20-27(24,25)17-6-7-19(26-4)18(11-17)21-16(3)23/h6-7,11,14-15,20H,5,8-10,12-13H2,1-4H3,(H,21,23)/t14-,15-/m0/s1 |
| InChIKey | PTFMRPIZSAUUFB-GJZGRUSLSA-N |
| XLogP | 2.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|