C15H20Cl2N4O — CID 94146394
(1S)-2,2-dichloro-1-methyl-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 94146394) has the molecular formula C15H20Cl2N4O and a molecular weight of 343.26 g/mol. Its IUPAC name is (1S)-2,2-dichloro-1-methyl-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-1-methyl-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94146394 |
| Molecular Formula | C15H20Cl2N4O |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (1S)-2,2-dichloro-1-methyl-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)[C@]3(C)CC3(Cl)Cl)nc2)CC1 |
| InChI | InChI=1S/C15H20Cl2N4O/c1-14(10-15(14,16)17)13(22)19-12-4-3-11(9-18-12)21-7-5-20(2)6-8-21/h3-4,9H,5-8,10H2,1-2H3,(H,18,19,22)/t14-/m0/s1 |
| InChIKey | DWIZOUBRWSPWQI-AWEZNQCLSA-N |
| XLogP | 2.36 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|