C11H9ClFN5O2 — CID 9414877
(4,6-diamino-1,3,5-triazin-2-yl)methyl 2-chloro-6-fluorobenzoate (PubChem CID 9414877) has the molecular formula C11H9ClFN5O2 and a molecular weight of 297.68 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-chloro-6-fluorobenzoate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 9414877 |
| Molecular Formula | C11H9ClFN5O2 |
| Molecular Weight | 297.68 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-chloro-6-fluorobenzoate |
| SMILES | Nc1nc(N)nc(COC(=O)c2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C11H9ClFN5O2/c12-5-2-1-3-6(13)8(5)9(19)20-4-7-16-10(14)18-11(15)17-7/h1-3H,4H2,(H4,14,15,16,17,18) |
| InChIKey | DXXBONHOMQZRMN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.68 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |