C16H16N2O4S2 — CID 9415076
[2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-2-oxoethyl] 5-methylthiophene-2-carboxylate (PubChem CID 9415076) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is [2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-2-oxoethyl] 5-methylthiophene-2-carboxylate.
| Compound Name | [2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-2-oxoethyl] 5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 9415076 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-2-oxoethyl] 5-methylthiophene-2-carboxylate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2ccccc2SCC(N)=O)s1 |
| InChI | InChI=1S/C16H16N2O4S2/c1-10-6-7-13(24-10)16(21)22-8-15(20)18-11-4-2-3-5-12(11)23-9-14(17)19/h2-7H,8-9H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | NDYVHGKQTQDUES-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |