C20H22N6O — CID 94164440
(2S)-2-(2-methylphenyl)-N-[3-(5-methyltetrazol-1-yl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 94164440) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is (2S)-2-(2-methylphenyl)-N-[3-(5-methyltetrazol-1-yl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-(2-methylphenyl)-N-[3-(5-methyltetrazol-1-yl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94164440 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (2S)-2-(2-methylphenyl)-N-[3-(5-methyltetrazol-1-yl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | Cc1ccccc1[C@@H]1CCCN1C(=O)Nc1cccc(-n2nnnc2C)c1 |
| InChI | InChI=1S/C20H22N6O/c1-14-7-3-4-10-18(14)19-11-6-12-25(19)20(27)21-16-8-5-9-17(13-16)26-15(2)22-23-24-26/h3-5,7-10,13,19H,6,11-12H2,1-2H3,(H,21,27)/t19-/m0/s1 |
| InChIKey | ULISTQIZRXOEGV-IBGZPJMESA-N |
| XLogP | 3.65 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |