C20H20Cl2N2O3 — CID 9417489
2,4-dichloro-N-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-2-oxoethyl]benzamide (PubChem CID 9417489) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9417489 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2,4-dichloro-N-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-2-oxoethyl]benzamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)CNC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-3-10-27-16-7-4-14(5-8-16)13-24(2)19(25)12-23-20(26)17-9-6-15(21)11-18(17)22/h3-9,11H,1,10,12-13H2,2H3,(H,23,26) |
| InChIKey | RGOJECBGOZBHGS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|