C13H23N5O2 — CID 94176749
[(3R)-1-[(2R)-2-hydroxy-3-pyrazol-1-ylpropyl]piperidin-3-yl]methylurea (PubChem CID 94176749) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is [(3R)-1-[(2R)-2-hydroxy-3-pyrazol-1-ylpropyl]piperidin-3-yl]methylurea.
| Compound Name | [(3R)-1-[(2R)-2-hydroxy-3-pyrazol-1-ylpropyl]piperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 94176749 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | [(3R)-1-[(2R)-2-hydroxy-3-pyrazol-1-ylpropyl]piperidin-3-yl]methylurea |
| SMILES | NC(=O)NC[C@H]1CCCN(C[C@@H](O)Cn2cccn2)C1 |
| InChI | InChI=1S/C13H23N5O2/c14-13(20)15-7-11-3-1-5-17(8-11)9-12(19)10-18-6-2-4-16-18/h2,4,6,11-12,19H,1,3,5,7-10H2,(H3,14,15,20)/t11-,12-/m1/s1 |
| InChIKey | ZCGIZIWFHCCOKC-VXGBXAGGSA-N |
| XLogP | -0.38 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |